CAS 1809102-39-3 appears in our catalog under these names: (E)-3,5-Dimethyl-4-(phenyldiazenyl)-1h-pyrazole, 95%, (E)-3,5-dimethyl-4-(phenyldiazenyl)-1h-pyrazole, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 1g, 100mg.
(3,5-dimethyl-1H-pyrazol-4-yl)-phenyldiazene (CAS 1809102-39-3) is a chemical compound with the molecular formula C11H12N4 and a molecular weight of 200.24 g/mol. IUPAC name: (3,5-dimethyl-1H-pyrazol-4-yl)-phenyldiazene. InChIKey: SUJFLVSMVSJQDE-UHFFFAOYSA-N.
| Molecular formula | C11H12N4 |
|---|---|
| Molecular weight | 200.24 g/mol |
| IUPAC name | (3,5-dimethyl-1H-pyrazol-4-yl)-phenyldiazene |
| InChIKey | SUJFLVSMVSJQDE-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1)C)N=NC2=CC=CC=C2 |
Computed by PubChem (NCBI)