Products 1094428-46-2
CAS 1094428-46-2 appears in our catalog under these names: 1-Cyclopropyl-2-methyl-1,3-benzodiazole-5-carboxylic acid, 98%, 1-Cyclopropyl-2-methyl-1H-1,3-benzodiazole-5-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 25g, 1g, 5g, 2,5g.
1-cyclopropyl-2-methylbenzimidazole-5-carboxylic acid (CAS 1094428-46-2) is a chemical compound with the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. IUPAC name: 1-cyclopropyl-2-methylbenzimidazole-5-carboxylic acid. InChIKey: LQPGSZKLSRZBGH-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O2 |
|---|---|
| Molecular weight | 216.24 g/mol |
| IUPAC name | 1-cyclopropyl-2-methylbenzimidazole-5-carboxylic acid |
| InChIKey | LQPGSZKLSRZBGH-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(N1C3CC3)C=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)