CAS 1094436-42-6 appears in our catalog under these names: 2-{(4-(chloromethyl)-1,3-thiazol-2-yl)methyl}-1,2-dihydrophthalazin-1-one, 98%, 2-{(4-(Chloromethyl)-1,3-thiazol-2-yl)methyl}-1,2-dihydrophthalazin-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]phthalazin-1-one (CAS 1094436-42-6) is a chemical compound with the molecular formula C13H10ClN3OS and a molecular weight of 291.76 g/mol. IUPAC name: 2-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]phthalazin-1-one. InChIKey: SRCGIMZGTMQTHI-UHFFFAOYSA-N.
| Molecular formula | C13H10ClN3OS |
|---|---|
| Molecular weight | 291.76 g/mol |
| IUPAC name | 2-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]phthalazin-1-one |
| InChIKey | SRCGIMZGTMQTHI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=NN(C2=O)CC3=NC(=CS3)CCl |
Computed by PubChem (NCBI)