CAS 537017-38-2 appears in our catalog under these names: 5-(4-Chlorophenyl)-4-(furan-2-ylmethyl)-4h-1,2,4-triazole-3-thiol, 95%, 95%, 3-(4-chlorophenyl)-4-[(furan-2-yl)methyl]-4,5-dihydro-1H-1,2,4-triazole-5-thione, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g.
3-(4-chlorophenyl)-4-(furan-2-ylmethyl)-1H-1,2,4-triazole-5-thione (CAS 537017-38-2) is a chemical compound with the molecular formula C13H10ClN3OS and a molecular weight of 291.76 g/mol. IUPAC name: 3-(4-chlorophenyl)-4-(furan-2-ylmethyl)-1H-1,2,4-triazole-5-thione. InChIKey: UVWPRSXBMKZBBG-UHFFFAOYSA-N.
| Molecular formula | C13H10ClN3OS |
|---|---|
| Molecular weight | 291.76 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-4-(furan-2-ylmethyl)-1H-1,2,4-triazole-5-thione |
| InChIKey | UVWPRSXBMKZBBG-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)CN2C(=NNC2=S)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)