CAS 694469-41-5 is the registry number for 5-(2-Chlorophenyl)-4-(furan-2-ylmethyl)-4H-1,2,4-triazole-3-thiol. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
3-(2-chlorophenyl)-4-(furan-2-ylmethyl)-1H-1,2,4-triazole-5-thione (CAS 694469-41-5) is a chemical compound with the molecular formula C13H10ClN3OS and a molecular weight of 291.76 g/mol. IUPAC name: 3-(2-chlorophenyl)-4-(furan-2-ylmethyl)-1H-1,2,4-triazole-5-thione. InChIKey: HUECFYBUQDVQCI-UHFFFAOYSA-N.
| Molecular formula | C13H10ClN3OS |
|---|---|
| Molecular weight | 291.76 g/mol |
| IUPAC name | 3-(2-chlorophenyl)-4-(furan-2-ylmethyl)-1H-1,2,4-triazole-5-thione |
| InChIKey | HUECFYBUQDVQCI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NNC(=S)N2CC3=CC=CO3)Cl |
Computed by PubChem (NCBI)