CAS 1094454-58-6 appears in our catalog under these names: 5-(2-(Difluoromethoxy)phenyl)-1,2,4-triazin-3-amine, 95%, 5-(2-(Difluoromethoxy)phenyl)-1,2,4-triazin-3-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
5-[2-(difluoromethoxy)phenyl]-1,2,4-triazin-3-amine (CAS 1094454-58-6) is a chemical compound with the molecular formula C10H8F2N4O and a molecular weight of 238.19 g/mol. IUPAC name: 5-[2-(difluoromethoxy)phenyl]-1,2,4-triazin-3-amine. InChIKey: JOSVPPHTKREXOM-UHFFFAOYSA-N.
| Molecular formula | C10H8F2N4O |
|---|---|
| Molecular weight | 238.19 g/mol |
| IUPAC name | 5-[2-(difluoromethoxy)phenyl]-1,2,4-triazin-3-amine |
| InChIKey | JOSVPPHTKREXOM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CN=NC(=N2)N)OC(F)F |
Computed by PubChem (NCBI)