Products 2012598-91-1
CAS 2012598-91-1 is the registry number for Rufinamide-15N,d2-1. Offered by: MedChemExpress. Available pack sizes: 1 mg.
1-[dideuterio-(2,6-difluorophenyl)methyl]triazole-4-(15N)carboxamide (CAS 2012598-91-1) is a chemical compound with the molecular formula C10H8F2N4O and a molecular weight of 241.20 g/mol. IUPAC name: 1-[dideuterio-(2,6-difluorophenyl)methyl]triazole-4-(15N)carboxamide. InChIKey: POGQSBRIGCQNEG-RPVANBMVSA-N.
| Molecular formula | C10H8F2N4O |
|---|---|
| Molecular weight | 241.20 g/mol |
| IUPAC name | 1-[dideuterio-(2,6-difluorophenyl)methyl]triazole-4-(15N)carboxamide |
| InChIKey | POGQSBRIGCQNEG-RPVANBMVSA-N |
| SMILES | [2H]C([2H])(C1=C(C=CC=C1F)F)N2C=C(N=N2)C(=O)[15NH2] |
Computed by PubChem (NCBI)