CAS 1622904-99-7 appears in our catalog under these names: Rufinamide Impurity 8, Rufinamide-5-Carboxamide, >95% (HPLC), Rufinamide-5-carboxamide, RUFINAMIDE 5-CARBOXAMIDE. Offered by: Chemat Brand, TRC, Biosynth, Sigma-Aldrich. Available pack sizes: on request, 0,5mg, 2,5mg, 5mg, 10mg, 25mg, 50mg.
3-[(2,6-difluorophenyl)methyl]triazole-4-carboxamide (CAS 1622904-99-7) is a chemical compound with the molecular formula C10H8F2N4O and a molecular weight of 238.19 g/mol. IUPAC name: 3-[(2,6-difluorophenyl)methyl]triazole-4-carboxamide. InChIKey: ZBAVQEMRPMTLRC-UHFFFAOYSA-N.
| Molecular formula | C10H8F2N4O |
|---|---|
| Molecular weight | 238.19 g/mol |
| IUPAC name | 3-[(2,6-difluorophenyl)methyl]triazole-4-carboxamide |
| InChIKey | ZBAVQEMRPMTLRC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)CN2C(=CN=N2)C(=O)N)F |
Computed by PubChem (NCBI)