Products 1094484-97-5
CAS 1094484-97-5 is the registry number for [(3-Bromo-5-fluorophenyl)methyl](propan-2-yl)amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
N-[(3-bromo-5-fluorophenyl)methyl]propan-2-amine (CAS 1094484-97-5) is a chemical compound with the molecular formula C10H13BrFN and a molecular weight of 246.12 g/mol. IUPAC name: N-[(3-bromo-5-fluorophenyl)methyl]propan-2-amine. InChIKey: JWLNJTWJSVHJPB-UHFFFAOYSA-N.
| Molecular formula | C10H13BrFN |
|---|---|
| Molecular weight | 246.12 g/mol |
| IUPAC name | N-[(3-bromo-5-fluorophenyl)methyl]propan-2-amine |
| InChIKey | JWLNJTWJSVHJPB-UHFFFAOYSA-N |
| SMILES | CC(C)NCC1=CC(=CC(=C1)Br)F |
Computed by PubChem (NCBI)