Products 1247575-72-9
CAS 1247575-72-9 is the registry number for N-(2-Bromo-4-fluorobenzyl)-n-methylethanamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
N-[(2-bromo-4-fluorophenyl)methyl]-N-methylethanamine (CAS 1247575-72-9) is a chemical compound with the molecular formula C10H13BrFN and a molecular weight of 246.12 g/mol. IUPAC name: N-[(2-bromo-4-fluorophenyl)methyl]-N-methylethanamine. InChIKey: LOKFCQYTORDKEL-UHFFFAOYSA-N.
| Molecular formula | C10H13BrFN |
|---|---|
| Molecular weight | 246.12 g/mol |
| IUPAC name | N-[(2-bromo-4-fluorophenyl)methyl]-N-methylethanamine |
| InChIKey | LOKFCQYTORDKEL-UHFFFAOYSA-N |
| SMILES | CCN(C)CC1=C(C=C(C=C1)F)Br |
Computed by PubChem (NCBI)