CAS 1809161-70-3 appears in our catalog under these names: 3-Bromo-5-fluoro-N,N-diethylaniline, 3-Bromo-5-fluoro-n,n-diethylaniline, 95%. Offered by: Fluorochem, Combi-blocks. Available pack sizes: 1g, 5g, 10g, 25g, 250mg.
3-bromo-N,N-diethyl-5-fluoroaniline (CAS 1809161-70-3) is a chemical compound with the molecular formula C10H13BrFN and a molecular weight of 246.12 g/mol. IUPAC name: 3-bromo-N,N-diethyl-5-fluoroaniline. InChIKey: NFCBENXFMAPRNZ-UHFFFAOYSA-N.
| Molecular formula | C10H13BrFN |
|---|---|
| Molecular weight | 246.12 g/mol |
| IUPAC name | 3-bromo-N,N-diethyl-5-fluoroaniline |
| InChIKey | NFCBENXFMAPRNZ-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC(=CC(=C1)Br)F |
Computed by PubChem (NCBI)