Products 1094523-25-7
CAS 1094523-25-7 is the registry number for N-(3-(3-Bromophenyl)propanoyl)-N-methylglycine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[3-(3-bromophenyl)propanoyl-methylamino]acetic acid (CAS 1094523-25-7) is a chemical compound with the molecular formula C12H14BrNO3 and a molecular weight of 300.15 g/mol. IUPAC name: 2-[3-(3-bromophenyl)propanoyl-methylamino]acetic acid. InChIKey: USTDVZSJTBZQJF-UHFFFAOYSA-N.
| Molecular formula | C12H14BrNO3 |
|---|---|
| Molecular weight | 300.15 g/mol |
| IUPAC name | 2-[3-(3-bromophenyl)propanoyl-methylamino]acetic acid |
| InChIKey | USTDVZSJTBZQJF-UHFFFAOYSA-N |
| SMILES | CN(CC(=O)O)C(=O)CCC1=CC(=CC=C1)Br |
Computed by PubChem (NCBI)