Products 1094533-48-8
CAS 1094533-48-8 appears in our catalog under these names: 2-Chloro-N-((3,4-dimethoxyphenyl)methyl)-N-methylpropanamide, 95%, 2-Chloro-N-((3,4-dimethoxyphenyl)methyl)-N-methylpropanamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
2-chloro-N-[(3,4-dimethoxyphenyl)methyl]-N-methylpropanamide (CAS 1094533-48-8) is a chemical compound with the molecular formula C13H18ClNO3 and a molecular weight of 271.74 g/mol. IUPAC name: 2-chloro-N-[(3,4-dimethoxyphenyl)methyl]-N-methylpropanamide. InChIKey: MWTSJKVLXYMPIV-UHFFFAOYSA-N.
| Molecular formula | C13H18ClNO3 |
|---|---|
| Molecular weight | 271.74 g/mol |
| IUPAC name | 2-chloro-N-[(3,4-dimethoxyphenyl)methyl]-N-methylpropanamide |
| InChIKey | MWTSJKVLXYMPIV-UHFFFAOYSA-N |
| SMILES | CC(C(=O)N(C)CC1=CC(=C(C=C1)OC)OC)Cl |
Computed by PubChem (NCBI)