Products 1094641-89-0
CAS 1094641-89-0 is the registry number for n-(3,5-Dichlorobenzyl)cyclopropanamine, 95%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
N-[(3,5-dichlorophenyl)methyl]cyclopropanamine (CAS 1094641-89-0) is a chemical compound with the molecular formula C10H11Cl2N and a molecular weight of 216.10 g/mol. IUPAC name: N-[(3,5-dichlorophenyl)methyl]cyclopropanamine. InChIKey: XPLRLEHFWZCNLZ-UHFFFAOYSA-N.
| Molecular formula | C10H11Cl2N |
|---|---|
| Molecular weight | 216.10 g/mol |
| IUPAC name | N-[(3,5-dichlorophenyl)methyl]cyclopropanamine |
| InChIKey | XPLRLEHFWZCNLZ-UHFFFAOYSA-N |
| SMILES | C1CC1NCC2=CC(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)