CAS 109518-50-5 appears in our catalog under these names: Etodolac EP Impurity C, (-)-Desethyl Methyl Etodolac, Etodolac related compound A, Etodolac Impurity 3 (Etodolac EP Impurity C). Offered by: Chemat Brand, TRC, Biosynth, Hubei YoungXin. Available pack sizes: on request, 100mg, 25mg, 5mg, 10mg, 50mg, 200mg.
2-(8-ethyl-1-methyl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)acetic acid (CAS 109518-50-5) is a chemical compound with the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. IUPAC name: 2-(8-ethyl-1-methyl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)acetic acid. InChIKey: FCSFORLYLNCXPD-UHFFFAOYSA-N.
| Molecular formula | C16H19NO3 |
|---|---|
| Molecular weight | 273.33 g/mol |
| IUPAC name | 2-(8-ethyl-1-methyl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)acetic acid |
| InChIKey | FCSFORLYLNCXPD-UHFFFAOYSA-N |
| SMILES | CCC1=C2C(=CC=C1)C3=C(N2)C(OCC3)(C)CC(=O)O |
Computed by PubChem (NCBI)