CAS 1932030-66-4 is the registry number for (4Ar,7as)-benzyl 7-oxohexahydro-1h-cyclopenta[c]pyridine-2(3h)-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Benzyl (4aR,7aS)-7-oxo-3,4,4a,5,6,7a-hexahydro-1H-cyclopenta[c]pyridine-2-carboxylate (CAS 1932030-66-4) is a chemical compound with the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. IUPAC name: benzyl (4aR,7aS)-7-oxo-3,4,4a,5,6,7a-hexahydro-1H-cyclopenta[c]pyridine-2-carboxylate. InChIKey: MOKKTXDDVHSSBZ-ZIAGYGMSSA-N.
| Molecular formula | C16H19NO3 |
|---|---|
| Molecular weight | 273.33 g/mol |
| IUPAC name | benzyl (4aR,7aS)-7-oxo-3,4,4a,5,6,7a-hexahydro-1H-cyclopenta[c]pyridine-2-carboxylate |
| InChIKey | MOKKTXDDVHSSBZ-ZIAGYGMSSA-N |
| SMILES | C1CC(=O)[C@H]2[C@H]1CCN(C2)C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)