CAS 1251003-85-6 is the registry number for (3Ar*,8ar*)-tert-butyl 8-oxo-3,3a,8,8a-tetrahydroindeno[1,2-c]pyrrole-2(1h)-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
Tert-butyl (3aR,8bR)-4-oxo-1,3,3a,8b-tetrahydroindeno[1,2-c]pyrrole-2-carboxylate (CAS 1251003-85-6) is a chemical compound with the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. IUPAC name: tert-butyl (3aR,8bR)-4-oxo-1,3,3a,8b-tetrahydroindeno[1,2-c]pyrrole-2-carboxylate. InChIKey: JKZDTRIMZKHSOR-STQMWFEESA-N.
| Molecular formula | C16H19NO3 |
|---|---|
| Molecular weight | 273.33 g/mol |
| IUPAC name | tert-butyl (3aR,8bR)-4-oxo-1,3,3a,8b-tetrahydroindeno[1,2-c]pyrrole-2-carboxylate |
| InChIKey | JKZDTRIMZKHSOR-STQMWFEESA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2[C@H](C1)C(=O)C3=CC=CC=C23 |
Computed by PubChem (NCBI)