CAS 1095565-81-3 is the registry number for AMG-221. Offered by: MedChemExpress. Available pack sizes: 5mg, 50mg, 110mg, 10mg, 100mg.
(5S)-2-[[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]imino]-5-methyl-5-propan-2-yl-1,3-thiazolidin-4-one (CAS 1095565-81-3) is a chemical compound with the molecular formula C14H22N2OS and a molecular weight of 266.40 g/mol. IUPAC name: (5S)-2-[[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]imino]-5-methyl-5-propan-2-yl-1,3-thiazolidin-4-one. InChIKey: YCNCXQNUXCHRRX-ZHPDPMBESA-N.
| Molecular formula | C14H22N2OS |
|---|---|
| Molecular weight | 266.40 g/mol |
| IUPAC name | (5S)-2-[[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]imino]-5-methyl-5-propan-2-yl-1,3-thiazolidin-4-one |
| InChIKey | YCNCXQNUXCHRRX-ZHPDPMBESA-N |
| SMILES | CC(C)[C@]1(C(=O)NC(=N[C@H]2C[C@@H]3CC[C@H]2C3)S1)C |
Computed by PubChem (NCBI)