CAS 551950-44-8 is the registry number for N-(3-tert-Butylsulfanyl-pyridin-2-yl)-2,2-dimethyl-propionamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
N-(3-tert-butylsulfanyl-2-pyridinyl)-2,2-dimethylpropanamide (CAS 551950-44-8) is a chemical compound with the molecular formula C14H22N2OS and a molecular weight of 266.40 g/mol. IUPAC name: N-(3-tert-butylsulfanyl-2-pyridinyl)-2,2-dimethylpropanamide. InChIKey: YAEGKCCMYHKSKA-UHFFFAOYSA-N.
| Molecular formula | C14H22N2OS |
|---|---|
| Molecular weight | 266.40 g/mol |
| IUPAC name | N-(3-tert-butylsulfanyl-2-pyridinyl)-2,2-dimethylpropanamide |
| InChIKey | YAEGKCCMYHKSKA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=C(C=CC=N1)SC(C)(C)C |
Computed by PubChem (NCBI)