Products 2647886-95-9
CAS 2647886-95-9 is the registry number for (R)-N-((R)-1-(Indolin-4-yl)ethyl)-2-methylpropane-2-sulfinamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(R)-N-[(1R)-1-(2,3-dihydro-1H-indol-4-yl)ethyl]-2-methylpropane-2-sulfinamide (CAS 2647886-95-9) is a chemical compound with the molecular formula C14H22N2OS and a molecular weight of 266.40 g/mol. IUPAC name: (R)-N-[(1R)-1-(2,3-dihydro-1H-indol-4-yl)ethyl]-2-methylpropane-2-sulfinamide. InChIKey: YZXZUZFFNWBGGM-MLCYQJTMSA-N.
| Molecular formula | C14H22N2OS |
|---|---|
| Molecular weight | 266.40 g/mol |
| IUPAC name | (R)-N-[(1R)-1-(2,3-dihydro-1H-indol-4-yl)ethyl]-2-methylpropane-2-sulfinamide |
| InChIKey | YZXZUZFFNWBGGM-MLCYQJTMSA-N |
| SMILES | C[C@H](C1=C2CCNC2=CC=C1)N[S@](=O)C(C)(C)C |
Computed by PubChem (NCBI)