Products 1095824-76-2

CAS 1095824-76-2 appears in our catalog under these names: 2–Acetylthiazole–5–carboxylic acid, 2-Acetylthiazole-5-carboxylic acid, 2-Acetylthiazole-5-carboxylic acid, 95%, 2-Acetylthiazole-5-carboxylic acid 98%, 2-Acetylthiazole-5-carboxylic acid, 97%. Offered by: GLPBio, Biosynth, Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 100mg, 2,5g, 1g, 250mg, 100g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

2-acetyl-1,3-thiazole-5-carboxylic acid (CAS 1095824-76-2) is a chemical compound with the molecular formula C6H5NO3S and a molecular weight of 171.18 g/mol. IUPAC name: 2-acetyl-1,3-thiazole-5-carboxylic acid. InChIKey: LIFGFPYQXSGAQL-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5NO3S
Molecular weight171.18 g/mol
IUPAC name2-acetyl-1,3-thiazole-5-carboxylic acid
InChIKeyLIFGFPYQXSGAQL-UHFFFAOYSA-N
SMILESCC(=O)C1=NC=C(S1)C(=O)O

Computed by PubChem (NCBI)