Products 1935538-41-2

CAS 1935538-41-2 is the registry number for 4-Acetylthiazole-2-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

4-acetyl-1,3-thiazole-2-carboxylic acid (CAS 1935538-41-2) is a chemical compound with the molecular formula C6H5NO3S and a molecular weight of 171.18 g/mol. IUPAC name: 4-acetyl-1,3-thiazole-2-carboxylic acid. InChIKey: FSOHHBGVANGRDI-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5NO3S
Molecular weight171.18 g/mol
IUPAC name4-acetyl-1,3-thiazole-2-carboxylic acid
InChIKeyFSOHHBGVANGRDI-UHFFFAOYSA-N
SMILESCC(=O)C1=CSC(=N1)C(=O)O

Computed by PubChem (NCBI)