CAS 80882-33-3 is the registry number for 4-Nitro-2-sulfanylphenol. Offered by: TRC. Available pack sizes: 250mg.
4-nitro-2-sulfanylphenol (CAS 80882-33-3) is a chemical compound with the molecular formula C6H5NO3S and a molecular weight of 171.18 g/mol. IUPAC name: 4-nitro-2-sulfanylphenol. InChIKey: DWPJITHBBYXNHW-UHFFFAOYSA-N.
| Molecular formula | C6H5NO3S |
|---|---|
| Molecular weight | 171.18 g/mol |
| IUPAC name | 4-nitro-2-sulfanylphenol |
| InChIKey | DWPJITHBBYXNHW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])S)O |
Computed by PubChem (NCBI)