Products 1096291-52-9

CAS 1096291-52-9 is the registry number for N-Ethyl 4-bromo-3-nitrobenzamide, 97%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

4-bromo-N-ethyl-3-nitrobenzamide (CAS 1096291-52-9) is a chemical compound with the molecular formula C9H9BrN2O3 and a molecular weight of 273.08 g/mol. IUPAC name: 4-bromo-N-ethyl-3-nitrobenzamide. InChIKey: CBAINLIMJMMFGC-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9BrN2O3
Molecular weight273.08 g/mol
IUPAC name4-bromo-N-ethyl-3-nitrobenzamide
InChIKeyCBAINLIMJMMFGC-UHFFFAOYSA-N
SMILESCCNC(=O)C1=CC(=C(C=C1)Br)[N+](=O)[O-]

Computed by PubChem (NCBI)