CAS 929000-26-0 appears in our catalog under these names: N,N-Dimethyl 3-bromo-5-nitrobenzamide, 98%, 3-Bromo-N,N-dimethyl-5-nitrobenzamide, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 25g.
3-bromo-N,N-dimethyl-5-nitrobenzamide (CAS 929000-26-0) is a chemical compound with the molecular formula C9H9BrN2O3 and a molecular weight of 273.08 g/mol. IUPAC name: 3-bromo-N,N-dimethyl-5-nitrobenzamide. InChIKey: PTTSRYCEMAFIIT-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN2O3 |
|---|---|
| Molecular weight | 273.08 g/mol |
| IUPAC name | 3-bromo-N,N-dimethyl-5-nitrobenzamide |
| InChIKey | PTTSRYCEMAFIIT-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC(=CC(=C1)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)