CAS 1369813-86-4 is the registry number for 2-Bromo-N,N-dimethyl-3-nitrobenzamide, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-bromo-N,N-dimethyl-3-nitrobenzamide (CAS 1369813-86-4) is a chemical compound with the molecular formula C9H9BrN2O3 and a molecular weight of 273.08 g/mol. IUPAC name: 2-bromo-N,N-dimethyl-3-nitrobenzamide. InChIKey: UDXSVVLOIZWZDY-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN2O3 |
|---|---|
| Molecular weight | 273.08 g/mol |
| IUPAC name | 2-bromo-N,N-dimethyl-3-nitrobenzamide |
| InChIKey | UDXSVVLOIZWZDY-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=C(C(=CC=C1)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)