CAS 109660-13-1 appears in our catalog under these names: 2-(4,4-Dimethyl-4,5-dihydro-2-oxazolyl)quinoline, 95%, 4,4-Dimethyl-2-(quinolin-2-yl)-4,5-dihydrooxazole, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
4,4-dimethyl-2-quinolin-2-yl-5H-1,3-oxazole (CAS 109660-13-1) is a chemical compound with the molecular formula C14H14N2O and a molecular weight of 226.27 g/mol. IUPAC name: 4,4-dimethyl-2-quinolin-2-yl-5H-1,3-oxazole. InChIKey: QCVNRITUPLGEMZ-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | 4,4-dimethyl-2-quinolin-2-yl-5H-1,3-oxazole |
| InChIKey | QCVNRITUPLGEMZ-UHFFFAOYSA-N |
| SMILES | CC1(COC(=N1)C2=NC3=CC=CC=C3C=C2)C |
Computed by PubChem (NCBI)