Products 1096802-87-7
CAS 1096802-87-7 is the registry number for 4-(Cyanomethoxy)-5-methoxy-2-nitrobenzoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-(cyanomethoxy)-5-methoxy-2-nitrobenzoic acid (CAS 1096802-87-7) is a chemical compound with the molecular formula C10H8N2O6 and a molecular weight of 252.18 g/mol. IUPAC name: 4-(cyanomethoxy)-5-methoxy-2-nitrobenzoic acid. InChIKey: UJNDDUBWBAQDEF-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O6 |
|---|---|
| Molecular weight | 252.18 g/mol |
| IUPAC name | 4-(cyanomethoxy)-5-methoxy-2-nitrobenzoic acid |
| InChIKey | UJNDDUBWBAQDEF-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C(=O)O)[N+](=O)[O-])OCC#N |
Computed by PubChem (NCBI)