CAS 17124-57-1 is the registry number for 3-(6-Nitro-2-oxo-2,3-dihydro-1,3-benzoxazol-3-yl)propanoic acid. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
3-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)propanoic acid (CAS 17124-57-1) is a chemical compound with the molecular formula C10H8N2O6 and a molecular weight of 252.18 g/mol. IUPAC name: 3-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)propanoic acid. InChIKey: UJEWPPYUQITRIB-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O6 |
|---|---|
| Molecular weight | 252.18 g/mol |
| IUPAC name | 3-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)propanoic acid |
| InChIKey | UJEWPPYUQITRIB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])OC(=O)N2CCC(=O)O |
Computed by PubChem (NCBI)