CAS 1096852-39-9 is the registry number for N-((2,5-Difluorophenyl)methyl)aniline. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
N-[(2,5-difluorophenyl)methyl]aniline (CAS 1096852-39-9) is a chemical compound with the molecular formula C13H11F2N and a molecular weight of 219.23 g/mol. IUPAC name: N-[(2,5-difluorophenyl)methyl]aniline. InChIKey: DPYKIPWWUAZAST-UHFFFAOYSA-N.
| Molecular formula | C13H11F2N |
|---|---|
| Molecular weight | 219.23 g/mol |
| IUPAC name | N-[(2,5-difluorophenyl)methyl]aniline |
| InChIKey | DPYKIPWWUAZAST-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NCC2=C(C=CC(=C2)F)F |
Computed by PubChem (NCBI)