CAS 1183538-54-6 is the registry number for 2',4'-Difluoro-biphenyl-4-methanamine hydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 1g.
[4-(2,4-difluorophenyl)phenyl]methanamine (CAS 1183538-54-6) is a chemical compound with the molecular formula C13H11F2N and a molecular weight of 219.23 g/mol. IUPAC name: [4-(2,4-difluorophenyl)phenyl]methanamine. InChIKey: ZCNDBTNLIAEYJZ-UHFFFAOYSA-N.
| Molecular formula | C13H11F2N |
|---|---|
| Molecular weight | 219.23 g/mol |
| IUPAC name | [4-(2,4-difluorophenyl)phenyl]methanamine |
| InChIKey | ZCNDBTNLIAEYJZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN)C2=C(C=C(C=C2)F)F |
Computed by PubChem (NCBI)