CAS 1691842-36-0 is the registry number for 3',4'-Difluoro-2-methyl-[1,1'-biphenyl]-3-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-(3,4-difluorophenyl)-2-methylaniline (CAS 1691842-36-0) is a chemical compound with the molecular formula C13H11F2N and a molecular weight of 219.23 g/mol. IUPAC name: 3-(3,4-difluorophenyl)-2-methylaniline. InChIKey: SWKPWPCHHAZWJF-UHFFFAOYSA-N.
| Molecular formula | C13H11F2N |
|---|---|
| Molecular weight | 219.23 g/mol |
| IUPAC name | 3-(3,4-difluorophenyl)-2-methylaniline |
| InChIKey | SWKPWPCHHAZWJF-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1N)C2=CC(=C(C=C2)F)F |
Computed by PubChem (NCBI)