Products 1096859-74-3
CAS 1096859-74-3 is the registry number for 2-Chloro-4-(4-methoxypiperidine-1-carbonyl)phenol. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(3-chloro-4-hydroxyphenyl)-(4-methoxypiperidin-1-yl)methanone (CAS 1096859-74-3) is a chemical compound with the molecular formula C13H16ClNO3 and a molecular weight of 269.72 g/mol. IUPAC name: (3-chloro-4-hydroxyphenyl)-(4-methoxypiperidin-1-yl)methanone. InChIKey: PFZJYLZIINXFLP-UHFFFAOYSA-N.
| Molecular formula | C13H16ClNO3 |
|---|---|
| Molecular weight | 269.72 g/mol |
| IUPAC name | (3-chloro-4-hydroxyphenyl)-(4-methoxypiperidin-1-yl)methanone |
| InChIKey | PFZJYLZIINXFLP-UHFFFAOYSA-N |
| SMILES | COC1CCN(CC1)C(=O)C2=CC(=C(C=C2)O)Cl |
Computed by PubChem (NCBI)