CAS 1096862-66-6 appears in our catalog under these names: 3-(2-(3-Ethylphenoxy)-5-fluorophenyl)prop-2-enoic acid, 95%, (2E)-3-(2-(3-Ethylphenoxy)-5-fluorophenyl)prop-2-enoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
(E)-3-[2-(3-ethylphenoxy)-5-fluorophenyl]prop-2-enoic acid (CAS 1096862-66-6) is a chemical compound with the molecular formula C17H15FO3 and a molecular weight of 286.30 g/mol. IUPAC name: (E)-3-[2-(3-ethylphenoxy)-5-fluorophenyl]prop-2-enoic acid. InChIKey: FQAVQTSHGYTFEQ-RMKNXTFCSA-N.
| Molecular formula | C17H15FO3 |
|---|---|
| Molecular weight | 286.30 g/mol |
| IUPAC name | (E)-3-[2-(3-ethylphenoxy)-5-fluorophenyl]prop-2-enoic acid |
| InChIKey | FQAVQTSHGYTFEQ-RMKNXTFCSA-N |
| SMILES | CCC1=CC(=CC=C1)OC2=C(C=C(C=C2)F)/C=C/C(=O)O |
Computed by PubChem (NCBI)