Products 1346457-87-1
CAS 1346457-87-1 is the registry number for (2E)-3-(2,5-Dimethoxyphenyl)-1-(4-fluorophenyl)prop-2-en-1-one, 98%, 98%. Offered by: Chemat. Available pack sizes: 1g, 5g.
(E)-3-(2,5-dimethoxyphenyl)-1-(4-fluorophenyl)prop-2-en-1-one (CAS 1346457-87-1) is a chemical compound with the molecular formula C17H15FO3 and a molecular weight of 286.30 g/mol. IUPAC name: (E)-3-(2,5-dimethoxyphenyl)-1-(4-fluorophenyl)prop-2-en-1-one. InChIKey: WNEXAQQSIRHLFE-WEVVVXLNSA-N.
| Molecular formula | C17H15FO3 |
|---|---|
| Molecular weight | 286.30 g/mol |
| IUPAC name | (E)-3-(2,5-dimethoxyphenyl)-1-(4-fluorophenyl)prop-2-en-1-one |
| InChIKey | WNEXAQQSIRHLFE-WEVVVXLNSA-N |
| SMILES | COC1=CC(=C(C=C1)OC)/C=C/C(=O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)