CAS 394-26-3 is the registry number for 1-(2,4-Dimethoxyphenyl)-3-(4-fluorophenyl)prop-2-en-1-one, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-1-(2,4-dimethoxyphenyl)-3-(4-fluorophenyl)prop-2-en-1-one (CAS 394-26-3) is a chemical compound with the molecular formula C17H15FO3 and a molecular weight of 286.30 g/mol. IUPAC name: (E)-1-(2,4-dimethoxyphenyl)-3-(4-fluorophenyl)prop-2-en-1-one. InChIKey: FRCWAQMDSSPPFN-BJMVGYQFSA-N.
| Molecular formula | C17H15FO3 |
|---|---|
| Molecular weight | 286.30 g/mol |
| IUPAC name | (E)-1-(2,4-dimethoxyphenyl)-3-(4-fluorophenyl)prop-2-en-1-one |
| InChIKey | FRCWAQMDSSPPFN-BJMVGYQFSA-N |
| SMILES | COC1=CC(=C(C=C1)C(=O)/C=C/C2=CC=C(C=C2)F)OC |
Computed by PubChem (NCBI)