Products 1096878-94-2
CAS 1096878-94-2 is the registry number for 2-(Chloro(phenyl)methyl)-5-methyl-1H-1,3-benzodiazole. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
2-[chloro(phenyl)methyl]-6-methyl-1H-benzimidazole (CAS 1096878-94-2) is a chemical compound with the molecular formula C15H13ClN2 and a molecular weight of 256.73 g/mol. IUPAC name: 2-[chloro(phenyl)methyl]-6-methyl-1H-benzimidazole. InChIKey: WJCJSSOCYHSKSY-UHFFFAOYSA-N.
| Molecular formula | C15H13ClN2 |
|---|---|
| Molecular weight | 256.73 g/mol |
| IUPAC name | 2-[chloro(phenyl)methyl]-6-methyl-1H-benzimidazole |
| InChIKey | WJCJSSOCYHSKSY-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N=C(N2)C(C3=CC=CC=C3)Cl |
Computed by PubChem (NCBI)