CAS 1694-78-6 appears in our catalog under these names: Normedazepam, >95% (HPLC), Normedazepam. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 10mg, 50mg.
7-chloro-5-phenyl-2,3-dihydro-1H-1,4-benzodiazepine (CAS 1694-78-6) is a chemical compound with the molecular formula C15H13ClN2 and a molecular weight of 256.73 g/mol. IUPAC name: 7-chloro-5-phenyl-2,3-dihydro-1H-1,4-benzodiazepine. InChIKey: JZWOKDTXYPEJEW-UHFFFAOYSA-N.
| Molecular formula | C15H13ClN2 |
|---|---|
| Molecular weight | 256.73 g/mol |
| IUPAC name | 7-chloro-5-phenyl-2,3-dihydro-1H-1,4-benzodiazepine |
| InChIKey | JZWOKDTXYPEJEW-UHFFFAOYSA-N |
| SMILES | C1CN=C(C2=C(N1)C=CC(=C2)Cl)C3=CC=CC=C3 |
Computed by PubChem (NCBI)