CAS 65197-47-9 appears in our catalog under these names: 2-Phenylquinolin-4-amine hydrochloride, 95%, 2-Phenylquinolin-4-amine hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g, 0,5g.
2-phenylquinolin-4-amine;hydrochloride (CAS 65197-47-9) is a chemical compound with the molecular formula C15H13ClN2 and a molecular weight of 256.73 g/mol. IUPAC name: 2-phenylquinolin-4-amine;hydrochloride. InChIKey: WKNBMKQOTRRCLC-UHFFFAOYSA-N.
| Molecular formula | C15H13ClN2 |
|---|---|
| Molecular weight | 256.73 g/mol |
| IUPAC name | 2-phenylquinolin-4-amine;hydrochloride |
| InChIKey | WKNBMKQOTRRCLC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC3=CC=CC=C3C(=C2)N.Cl |
Computed by PubChem (NCBI)