CAS 1096911-64-6 is the registry number for 1-(2,4-Difluorophenyl)-5-(propan-2-yl)-1H-1,2,3-triazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-(2,4-difluorophenyl)-5-propan-2-yltriazole-4-carboxylic acid (CAS 1096911-64-6) is a chemical compound with the molecular formula C12H11F2N3O2 and a molecular weight of 267.23 g/mol. IUPAC name: 1-(2,4-difluorophenyl)-5-propan-2-yltriazole-4-carboxylic acid. InChIKey: MODDXIFPKJCNQU-UHFFFAOYSA-N.
| Molecular formula | C12H11F2N3O2 |
|---|---|
| Molecular weight | 267.23 g/mol |
| IUPAC name | 1-(2,4-difluorophenyl)-5-propan-2-yltriazole-4-carboxylic acid |
| InChIKey | MODDXIFPKJCNQU-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(N=NN1C2=C(C=C(C=C2)F)F)C(=O)O |
Computed by PubChem (NCBI)