Products 848486-56-6
CAS 848486-56-6 is the registry number for Methylthiomcresol-C1-benzoic acid. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[(3-methyl-4-methylsulfanylphenoxy)methyl]benzoic acid (CAS 848486-56-6) is a chemical compound with the molecular formula C16H16O3S and a molecular weight of 288.4 g/mol. IUPAC name: 4-[(3-methyl-4-methylsulfanylphenoxy)methyl]benzoic acid. InChIKey: NZBCZBBZAPZWRB-UHFFFAOYSA-N.
| Molecular formula | C16H16O3S |
|---|---|
| Molecular weight | 288.4 g/mol |
| IUPAC name | 4-[(3-methyl-4-methylsulfanylphenoxy)methyl]benzoic acid |
| InChIKey | NZBCZBBZAPZWRB-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)OCC2=CC=C(C=C2)C(=O)O)SC |
Computed by PubChem (NCBI)