CAS 1097017-99-6 appears in our catalog under these names: 1-(2,3-Dihydro-1,4-benzodioxin-6-yl)-5-methyl-1h-1,2,3-triazole-4-carboxylic acid, 95%, 1-(2,3-Dihydro-1,4-benzodioxin-6-yl)-5-methyl-1H-1,2,3-triazole-4-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 1g, 50mg, 0,5g.
1-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-methyltriazole-4-carboxylic acid (CAS 1097017-99-6) is a chemical compound with the molecular formula C12H11N3O4 and a molecular weight of 261.23 g/mol. IUPAC name: 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-methyltriazole-4-carboxylic acid. InChIKey: SPUKSOAJZKGHPL-UHFFFAOYSA-N.
| Molecular formula | C12H11N3O4 |
|---|---|
| Molecular weight | 261.23 g/mol |
| IUPAC name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-methyltriazole-4-carboxylic acid |
| InChIKey | SPUKSOAJZKGHPL-UHFFFAOYSA-N |
| SMILES | CC1=C(N=NN1C2=CC3=C(C=C2)OCCO3)C(=O)O |
Computed by PubChem (NCBI)