CAS 491831-82-4 appears in our catalog under these names: 3-[(5-Methyl-3-nitro-1h-pyrazol-1-yl)methyl]benzoic acid, 96%, 3-((5-Methyl-3-nitro-pyrazol-1-yl)methyl)benzoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 2,5g.
3-[(5-methyl-3-nitropyrazol-1-yl)methyl]benzoic acid (CAS 491831-82-4) is a chemical compound with the molecular formula C12H11N3O4 and a molecular weight of 261.23 g/mol. IUPAC name: 3-[(5-methyl-3-nitropyrazol-1-yl)methyl]benzoic acid. InChIKey: IDBOQHVHOATSKD-UHFFFAOYSA-N.
| Molecular formula | C12H11N3O4 |
|---|---|
| Molecular weight | 261.23 g/mol |
| IUPAC name | 3-[(5-methyl-3-nitropyrazol-1-yl)methyl]benzoic acid |
| InChIKey | IDBOQHVHOATSKD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1CC2=CC(=CC=C2)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)