CAS 1258657-50-9 is the registry number for Ethyl 1-(2-nitrophenyl)pyrazole-3-carboxylate, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Ethyl 1-(2-nitrophenyl)pyrazole-3-carboxylate (CAS 1258657-50-9) is a chemical compound with the molecular formula C12H11N3O4 and a molecular weight of 261.23 g/mol. IUPAC name: ethyl 1-(2-nitrophenyl)pyrazole-3-carboxylate. InChIKey: NBHVNGRYOHBFTK-UHFFFAOYSA-N.
| Molecular formula | C12H11N3O4 |
|---|---|
| Molecular weight | 261.23 g/mol |
| IUPAC name | ethyl 1-(2-nitrophenyl)pyrazole-3-carboxylate |
| InChIKey | NBHVNGRYOHBFTK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NN(C=C1)C2=CC=CC=C2[N+](=O)[O-] |
Computed by PubChem (NCBI)