CAS 1097078-33-5 appears in our catalog under these names: 6-(2,6-Difluorobenzoyl)-2,3-dihydro-1,4-benzodioxine, 95%, 6-(2,6-Difluorobenzoyl)-2,3-dihydro-1,4-benzodioxine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
(2,6-difluorophenyl)-(2,3-dihydro-1,4-benzodioxin-6-yl)methanone (CAS 1097078-33-5) is a chemical compound with the molecular formula C15H10F2O3 and a molecular weight of 276.23 g/mol. IUPAC name: (2,6-difluorophenyl)-(2,3-dihydro-1,4-benzodioxin-6-yl)methanone. InChIKey: UWWFHJZRQCZMOS-UHFFFAOYSA-N.
| Molecular formula | C15H10F2O3 |
|---|---|
| Molecular weight | 276.23 g/mol |
| IUPAC name | (2,6-difluorophenyl)-(2,3-dihydro-1,4-benzodioxin-6-yl)methanone |
| InChIKey | UWWFHJZRQCZMOS-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=CC(=C2)C(=O)C3=C(C=CC=C3F)F |
Computed by PubChem (NCBI)