CAS 1403326-80-6 is the registry number for benzyl 3,5–difluoro–4–formylbenzoate. Offered by: GLPBio. Available pack sizes: 200mg.
Benzyl 3,5-difluoro-4-formylbenzoate (CAS 1403326-80-6) is a chemical compound with the molecular formula C15H10F2O3 and a molecular weight of 276.23 g/mol. IUPAC name: benzyl 3,5-difluoro-4-formylbenzoate. InChIKey: VBYPQQDGDPFMKN-UHFFFAOYSA-N.
| Molecular formula | C15H10F2O3 |
|---|---|
| Molecular weight | 276.23 g/mol |
| IUPAC name | benzyl 3,5-difluoro-4-formylbenzoate |
| InChIKey | VBYPQQDGDPFMKN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)C2=CC(=C(C(=C2)F)C=O)F |
Computed by PubChem (NCBI)