CAS 623944-98-9 is the registry number for 1-(2,6-Difluorophenyl)-3-(2-hydroxyphenyl)propane-1,3-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(2,6-difluorophenyl)-3-(2-hydroxyphenyl)propane-1,3-dione (CAS 623944-98-9) is a chemical compound with the molecular formula C15H10F2O3 and a molecular weight of 276.23 g/mol. IUPAC name: 1-(2,6-difluorophenyl)-3-(2-hydroxyphenyl)propane-1,3-dione. InChIKey: ZSHJKXPHRVVNID-UHFFFAOYSA-N.
| Molecular formula | C15H10F2O3 |
|---|---|
| Molecular weight | 276.23 g/mol |
| IUPAC name | 1-(2,6-difluorophenyl)-3-(2-hydroxyphenyl)propane-1,3-dione |
| InChIKey | ZSHJKXPHRVVNID-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)CC(=O)C2=C(C=CC=C2F)F)O |
Computed by PubChem (NCBI)