CAS 1097125-23-9 appears in our catalog under these names: 2-((3,4-Difluorophenyl)sulfanyl)-2-phenylacetic acid, 95%, 2-((3,4-Difluorophenyl)sulfanyl)-2-phenylacetic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
2-(3,4-difluorophenyl)sulfanyl-2-phenylacetic acid (CAS 1097125-23-9) is a chemical compound with the molecular formula C14H10F2O2S and a molecular weight of 280.29 g/mol. IUPAC name: 2-(3,4-difluorophenyl)sulfanyl-2-phenylacetic acid. InChIKey: QZXBDUATFRTRPZ-UHFFFAOYSA-N.
| Molecular formula | C14H10F2O2S |
|---|---|
| Molecular weight | 280.29 g/mol |
| IUPAC name | 2-(3,4-difluorophenyl)sulfanyl-2-phenylacetic acid |
| InChIKey | QZXBDUATFRTRPZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C(=O)O)SC2=CC(=C(C=C2)F)F |
Computed by PubChem (NCBI)