Products 1097168-07-4
CAS 1097168-07-4 appears in our catalog under these names: 3-{((2,5-difluorophenyl)sulfanyl)methyl}benzoic acid, 95%, 3-{((2,5-Difluorophenyl)sulfanyl)methyl}benzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
3-[(2,5-difluorophenyl)sulfanylmethyl]benzoic acid (CAS 1097168-07-4) is a chemical compound with the molecular formula C14H10F2O2S and a molecular weight of 280.29 g/mol. IUPAC name: 3-[(2,5-difluorophenyl)sulfanylmethyl]benzoic acid. InChIKey: RWVVSLYNWJZWFZ-UHFFFAOYSA-N.
| Molecular formula | C14H10F2O2S |
|---|---|
| Molecular weight | 280.29 g/mol |
| IUPAC name | 3-[(2,5-difluorophenyl)sulfanylmethyl]benzoic acid |
| InChIKey | RWVVSLYNWJZWFZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)CSC2=C(C=CC(=C2)F)F |
Computed by PubChem (NCBI)