Products 2136287-65-3
CAS 2136287-65-3 appears in our catalog under these names: Baloxavir Marboxil Impurity 17, 3，4–Difluoro–2–((phenylthio)methyl)benzoic acid, 3,4-Difluoro-2-((phenylthio)methyl)benzoic acid 97%, 3,4-Difluoro-2-((phenylthio)methyl)benzoic acid, 97%, 97%, 3,4-Difluoro-2-((phenylthio)methyl)benzoic acid, 97%. Offered by: Chemat Brand, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: on request, 100mg, 1g, 250mg.
3,4-difluoro-2-(phenylsulfanylmethyl)benzoic acid (CAS 2136287-65-3) is a chemical compound with the molecular formula C14H10F2O2S and a molecular weight of 280.29 g/mol. IUPAC name: 3,4-difluoro-2-(phenylsulfanylmethyl)benzoic acid. InChIKey: YLPPWUHTBLHWOM-UHFFFAOYSA-N.
| Molecular formula | C14H10F2O2S |
|---|---|
| Molecular weight | 280.29 g/mol |
| IUPAC name | 3,4-difluoro-2-(phenylsulfanylmethyl)benzoic acid |
| InChIKey | YLPPWUHTBLHWOM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)SCC2=C(C=CC(=C2F)F)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3,4-Difluoro-2-((phenylthio)methyl)benzoic acid, Baloxavir Impurity 17, 3,4-Difluoro-2-((phenylthio)methyl)benzoicacid, 3,4-Difluoro-2-[(phenylthio)methyl]benzoic acid, 3,4-difluoro-2-(phenylsulfanylmethyl)benzoic acid, Baloxavir Marboxil Impurity 23, Baloxavixate Impurity 20, Benzoic acid, 3,4-difluoro-2-[(phenylthio)methyl]-, 3,4-Difluoro-2-((phenylthio)methyl)benzoic AcidQ: What is, 3,4-Difluoro-2-((phenylthio)methyl)benzoic Acid Q: What is the CAS Number of